When ethanol was reacted with ethanoic acid to create ethyl ethanoate, why did it smell like nail polish remover instead of pears?

Md Ariful Islam

0 like 0 dislike
1 views
Share with your friends

1 Answers

Md Ariful Islam

Call
A smell of compound depends on a concentration. Ethyl ethanoate smells like pears at low levels and like nail-polish-remover at high concentration. You can dilute it if you want feel the smell of pears.
0 like 0 dislike
1 views
Talk Doctor Online in Bissoy App
The experiment is repeated with 1.0 M ethanoic acid to replace the sulphuric acid. Calculate the volume of ethanoic acid, CH3COOH needed to neutralize 25mL of potassium hydroxide solution

Molar mass of ethanoic acid = 60.052 g/MolMolar mass of KOH =56.105625/56.1056= 0.446mol0.446×60.052= 26.76ml of CH3COOH

1 Answers 1 views
what is the equation for the reaction of ethyl ethanoate with dilute acid

The general equation for the reaction (acidic hydrolysis) is: CH3COOC2H5 + H2O → CH3COOH + C2H5OH

1 Answers 1 views
How do i write equation for the reaction of ethyl ethanoate with dilute alkali. and which one is the better equations for obtaining the organic product?

The general equation for the reaction (hydrolysis) is: CH3COOC2H5 + MOH → CH3COOM + C2H5OH where M is an alkali metal The reactivity of bases decreases in the following order:...

1 Answers 1 views
Increasing order of their acidic strength propanoic acid,ethanoic acid,2-fluoroethanoic acid,2-chloroethanoic acid,dichloroethanoic acid Also give reasion .

Solution:- propanoic acid<ethanoic acid<2-chloroethanoic acid<2- fluoroethanoic acid<dichloroethanoic acid when alkyl group keeps increasing, electron pushing effect increases, more tha alkyl group, more the electron pushing, and more stronger the carbon...

1 Answers 1 views
Compare the relative acidities of ethanoic acid, propanoic acid, fluoroethanoic acid and iodoethanoic acid. Explain your answer giving appropriate answers.

Ethanoic acid: pKa = 4.76Propanoic acid: pKa = 4.87Fluoroethanoic acid: pKa = ‎2.59Iodoethanoic acid: pKa = 3.18So, the most acidic is the fluoroethanoic acid, then iodoethanoic acid, then ethanoic acid,...

1 Answers 1 views
Could you re do the previous question on how to write a multi step synthesis of ethyl ethanoate starting from ethanol and ethanal with clear notes

Starting Up The Ethanol To Ethyl Ethanoate Unit i) Testing and development of catalysts for high activity (>40% conversion of reaction proceeds to either ethanal or ethyl ethanoate, depending on reaction ... of the catalyst by the product...

1 Answers 1 views
<ol><li>propyl ethanoate</li><li>pentyl ethanoate</li><li>ethyl butanoate</li><li>ethyl methanoate</li></ol>

CH3C(O)OCH2CH2CH3CH3C(O)OCH2CH2CH2CH2CH3CH3CH2CH2C(O)OCH2CH3HC(O)OCH2CH3

1 Answers 1 views
The following pairs of liquids are miscible. Identify the predominant type of intermolecular attraction between each pair. a) 2-propanone and ethyl ethanoate (ethyl acetate)

Propanol has a hydrogen bond which is a strong intermolecular force. therefore, it will take more energy to break the bond, hence a higher boiling point.

1 Answers 1 views
What is the mass, in grams, of 28.46 mL of acetone? Acetone (nail polish remover) has a density of 0.7857 g/cm3.

r = m/V m = V*r V = 28.46 ml = 28.46 cm^3 m = 28.46*0.7857 = 22.36 g Answer: 22.36 g

1 Answers 1 views
What mass of ethanol is needed to create 2.5 gram of ethanoic acid (CH3COOH)? assume the ratio of ethanol to ethanoic acid needed is 1:1

m(CH3CH2OH) = 2,5g n(CH3CH2OH) : n(CH3COOH) = 1: 1 m(CH3COOH) = ? X g 2.5g CH3CH2OH → CH3COOH 46 g/moll 60 g/moll 46g (CH3CH2OH) ─ 60g (CH3COOH) X g (CH3CH2OH)...

1 Answers 1 views
X