1 Answers
Call
Talk Doctor Online in Bissoy App
what is the equation for the reaction of ethyl ethanoate with dilute acid
The general equation for the reaction (acidic hydrolysis) is: CH3COOC2H5 + H2O → CH3COOH + C2H5OH
1 Answers 1 views
How do i write equation for the reaction of ethyl ethanoate with dilute
alkali.
and which one is the better equations for obtaining the organic product?
The general equation for the reaction (hydrolysis) is: CH3COOC2H5 + MOH → CH3COOM + C2H5OH where M is an alkali metal The reactivity of bases decreases in the following order:...
1 Answers 1 views
When ethanol was reacted with ethanoic acid to create ethyl ethanoate, why did it smell like nail polish remover instead of pears?
A smell of compound depends on a concentration. Ethyl ethanoate smells like pears at low levels and like nail-polish-remover at high concentration. You can dilute it if you want feel...
1 Answers 1 views
Could you re do the previous question on how to write a multi step synthesis of ethyl ethanoate starting from ethanol and ethanal with clear notes
Starting Up The Ethanol To Ethyl Ethanoate Unit i) Testing and development of catalysts for high activity (>40% conversion of reaction proceeds to either ethanal or ethyl ethanoate, depending on reaction ... of the catalyst by the product...
1 Answers 1 views
<ol><li>propyl ethanoate</li><li>pentyl ethanoate</li><li>ethyl butanoate</li><li>ethyl methanoate</li></ol>
CH3C(O)OCH2CH2CH3CH3C(O)OCH2CH2CH2CH2CH3CH3CH2CH2C(O)OCH2CH3HC(O)OCH2CH3
1 Answers 1 views
Explain, in terms of intermolecular forces, why ethane nitrile and hexane are not miscible.
The weaker the intermolecular forces between solutions, the lesser the solubility of the solutions .Hexane are held together by London dispersion forces hence they cannot mix.
1 Answers 1 views
What is CST of a partially miscible liquid pair ? give one example each for the following liquid pairs which have
(a) lower CST
(b) upper CST
(c) both lower and upper CST
Partially miscible liquids necomemore soluble with the increase in temperature and at a certain temperature they become completely miscible.This temperature is known as the critical solution temperature (CST).liquid pairs which have(a) lower CST-triethylamine...
1 Answers 1 views
Why are the liquids, carbons tetrachloride and water, immiscible? Why, then are the liquids, ethyl alcohol and water, miscible in all proportions?
Carbon tetrachloride is a nonpolar compound that does not form hydrogen or ionic interactions with water molecules. As a result, this compound is immiscible with water. In contrast, ethyl alcohol...
1 Answers 1 views
Give an explanations for the fact that polar solids have a limit to their solubilities in water, whereas polar liquids may be miscible in all proportions?
Each polar solid is characterized by a certain level of sollubility - a maximum amount of solute that will dissolve in a given amount of solvent at a specified temperature...
1 Answers 1 views
80.0g of propanone was heated from 25.50C to 63.40C. How much energy was transferred to the propanone during heating? Specific heat of propanone is 2.13Jg-1 oC-1?
Solution:q = m × C × ΔTwhere:q = amount of heat energy gained or lost by substance (J)m = mass of sample (g)C = specific heat capacity of sample (J °C-1 g-1)ΔT =...
1 Answers 1 views